C17H17NO — CID 115107244
2-(1-benzyl-2,3-dihydroindol-6-yl)acetaldehyde (PubChem CID 115107244) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(1-benzyl-2,3-dihydroindol-6-yl)acetaldehyde.
| Compound Name | 2-(1-benzyl-2,3-dihydroindol-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 115107244 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(1-benzyl-2,3-dihydroindol-6-yl)acetaldehyde |
| SMILES | O=CCc1ccc2c(c1)N(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C17H17NO/c19-11-9-14-6-7-16-8-10-18(17(16)12-14)13-15-4-2-1-3-5-15/h1-7,11-12H,8-10,13H2 |
| InChIKey | GIMOVCCWDHGCIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|