C22H21N3O2 — CID 70300174
2-(1-benzyl-2,3-dihydroindol-6-yl)-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 70300174) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(1-benzyl-2,3-dihydroindol-6-yl)-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(1-benzyl-2,3-dihydroindol-6-yl)-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 70300174 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-(1-benzyl-2,3-dihydroindol-6-yl)-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1CN(c2ccc3c(c2)N(Cc2ccccc2)CC3)C(=O)C2=CCCN12 |
| InChI | InChI=1S/C22H21N3O2/c26-21-15-25(22(27)19-7-4-11-24(19)21)18-9-8-17-10-12-23(20(17)13-18)14-16-5-2-1-3-6-16/h1-3,5-9,13H,4,10-12,14-15H2 |
| InChIKey | ZBFOBCNQDKLSQQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|