About N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide
N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide (PubChem CID 142743440) has the molecular formula C22H26N2O
and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide |
| PubChem CID | 142743440 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)N(Cc1ccccc1)CC2)C1CCCCC1 |
| InChI | InChI=1S/C22H26N2O/c25-22(19-9-5-2-6-10-19)23-20-12-11-18-13-14-24(21(18)15-20)16-17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15,19H,2,5-6,9-10,13-14,16H2,(H,23,25) |
| InChIKey | SGBBPLNWDCSZLZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide?
The IUPAC name of N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide (CID 142743440) is N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide.
What is the SMILES notation for N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide?
The canonical SMILES for N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide is O=C(Nc1ccc2c(c1)N(Cc1ccccc1)CC2)C1CCCCC1.
What is the InChIKey of N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide?
The InChIKey is SGBBPLNWDCSZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O/c25-22(19-9-5-2-6-10-19)23-20-12-11-18-13-14-24(21(18)15-20)16-17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15,19H,2,5-6,9-10,13-14,16H2,(H,23,25).
What are the key properties of N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide?
N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide has a molecular weight of 334.46 g/mol, XLogP of 4.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzyl-2,3-dihydroindol-6-yl)cyclohexanecarboxamide is sourced from PubChem (CID 142743440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).