C19H21ClN2OS — CID 11210623
N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]cyclopentanecarboxamide (PubChem CID 11210623) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]cyclopentanecarboxamide.
| Compound Name | N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 11210623 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2Cc1ccc(Cl)s1)C1CCCC1 |
| InChI | InChI=1S/C19H21ClN2OS/c20-18-8-6-16(24-18)12-22-10-9-14-11-15(5-7-17(14)22)21-19(23)13-3-1-2-4-13/h5-8,11,13H,1-4,9-10,12H2,(H,21,23) |
| InChIKey | AUOZRASIFYBPPM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|