C18H20ClN3OS — CID 11233768
N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]pyrrolidine-1-carboxamide (PubChem CID 11233768) has the molecular formula C18H20ClN3OS and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 11233768 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[1-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroindol-5-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2Cc1ccc(Cl)s1)N1CCCC1 |
| InChI | InChI=1S/C18H20ClN3OS/c19-17-6-4-15(24-17)12-22-10-7-13-11-14(3-5-16(13)22)20-18(23)21-8-1-2-9-21/h3-6,11H,1-2,7-10,12H2,(H,20,23) |
| InChIKey | XRJGFWOKHCXSEE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|