C21H26N2O — CID 71811966
N-[1-[(4-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]acetamide (PubChem CID 71811966) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[1-[(4-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]acetamide.
| Compound Name | N-[1-[(4-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 71811966 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[1-[(4-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCCN2Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H26N2O/c1-15(2)18-8-6-17(7-9-18)14-23-12-4-5-19-13-20(22-16(3)24)10-11-21(19)23/h6-11,13,15H,4-5,12,14H2,1-3H3,(H,22,24) |
| InChIKey | ZQWUIOUQAHCLGN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|