C34H32F6N4O — CID 160896240
1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-amine;N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide (PubChem CID 160896240) has the molecular formula C34H32F6N4O and a molecular weight of 626.65 g/mol. Its IUPAC name is 1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-amine;N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide.
| Compound Name | 1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-amine;N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
|---|---|
| PubChem CID | 160896240 |
| Molecular Formula | C34H32F6N4O |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-amine;N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(F)(F)F)cc1.Nc1ccc2c(c1)CCN2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O.C16H15F3N2/c1-12(24)22-16-6-7-17-14(10-16)8-9-23(17)11-13-2-4-15(5-3-13)18(19,20)21;17-16(18,19)13-3-1-11(2-4-13)10-21-8-7-12-9-14(20)5-6-15(12)21/h2-7,10H,8-9,11H2,1H3,(H,22,24);1-6,9H,7-8,10,20H2 |
| InChIKey | SOXHKIHVUTUEAL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|