C21H20F6N2O3 — CID 118428789
ethyl N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]carbamate (PubChem CID 118428789) has the molecular formula C21H20F6N2O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is ethyl N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]carbamate.
| Compound Name | ethyl N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]carbamate |
|---|---|
| PubChem CID | 118428789 |
| Molecular Formula | C21H20F6N2O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | ethyl N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-2,3-dihydroindol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F6N2O3/c1-2-32-18(30)28-16-7-8-17-14(11-16)9-10-29(17)12-13-3-5-15(6-4-13)19(31,20(22,23)24)21(25,26)27/h3-8,11,31H,2,9-10,12H2,1H3,(H,28,30) |
| InChIKey | XPBSNKARKUJXBZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|