C21H19F6N3O — CID 149260817
2-[4-[[5-(1-amino-3-iminoprop-1-en-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 149260817) has the molecular formula C21H19F6N3O and a molecular weight of 443.39 g/mol. Its IUPAC name is 2-[4-[[5-(1-amino-3-iminoprop-1-en-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[5-(1-amino-3-iminoprop-1-en-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 149260817 |
| Molecular Formula | C21H19F6N3O |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[4-[[5-(1-amino-3-iminoprop-1-en-2-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | [H]/N=C/C(=CN)c1ccc2c(c1)CCN2Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F6N3O/c22-20(23,24)19(31,21(25,26)27)17-4-1-13(2-5-17)12-30-8-7-15-9-14(3-6-18(15)30)16(10-28)11-29/h1-6,9-11,28,31H,7-8,12,29H2/b16-11?,28-10+ |
| InChIKey | XPETUBMKGQTWPE-XJFAACKOSA-N |
| XLogP | 4.51 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|