C25H36N4O — CID 144921412
1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]-2-methylpyrrolidin-1-yl]-2-cyclohexylethanone (PubChem CID 144921412) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]-2-methylpyrrolidin-1-yl]-2-cyclohexylethanone.
| Compound Name | 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]-2-methylpyrrolidin-1-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 144921412 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-[4-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]-2-methylpyrrolidin-1-yl]-2-cyclohexylethanone |
| SMILES | [H]/N=C/C(=C\N)c1ccc2c(c1)CCN2CC1CC(C)N(C(=O)CC2CCCCC2)C1 |
| InChI | InChI=1S/C25H36N4O/c1-18-11-20(17-29(18)25(30)12-19-5-3-2-4-6-19)16-28-10-9-22-13-21(7-8-24(22)28)23(14-26)15-27/h7-8,13-15,18-20,26H,2-6,9-12,16-17,27H2,1H3/b23-15+,26-14+ |
| InChIKey | SJKLPVJMFVBKTC-UHELEBEGSA-N |
| XLogP | 4.21 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|