C26H36N4O — CID 144921388
N-[2-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]butyl]-N-methylbenzamide;ethane (PubChem CID 144921388) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[2-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]butyl]-N-methylbenzamide;ethane.
| Compound Name | N-[2-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]butyl]-N-methylbenzamide;ethane |
|---|---|
| PubChem CID | 144921388 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | N-[2-[[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2,3-dihydroindol-1-yl]methyl]butyl]-N-methylbenzamide;ethane |
| SMILES | CC.[H]/N=C/C(=C\N)c1ccc2c(c1)CCN2CC(CC)CN(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O.C2H6/c1-3-18(16-27(2)24(29)19-7-5-4-6-8-19)17-28-12-11-21-13-20(9-10-23(21)28)22(14-25)15-26;1-2/h4-10,13-15,18,25H,3,11-12,16-17,26H2,1-2H3;1-2H3/b22-15+,25-14+; |
| InChIKey | XPWQZVPFSMLUDK-AIOFORRKSA-N |
| XLogP | 4.82 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|