C27H36N4O — CID 144921313
(Z)-2-[1-[(1,5-dimethylpyrrolidin-3-yl)methyl]-2,3-dihydroindol-5-yl]-3-iminoprop-1-en-1-amine;3-phenylpropanal (PubChem CID 144921313) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is (Z)-2-[1-[(1,5-dimethylpyrrolidin-3-yl)methyl]-2,3-dihydroindol-5-yl]-3-iminoprop-1-en-1-amine;3-phenylpropanal.
| Compound Name | (Z)-2-[1-[(1,5-dimethylpyrrolidin-3-yl)methyl]-2,3-dihydroindol-5-yl]-3-iminoprop-1-en-1-amine;3-phenylpropanal |
|---|---|
| PubChem CID | 144921313 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (Z)-2-[1-[(1,5-dimethylpyrrolidin-3-yl)methyl]-2,3-dihydroindol-5-yl]-3-iminoprop-1-en-1-amine;3-phenylpropanal |
| SMILES | O=CCCc1ccccc1.[H]/N=C/C(=C\N)c1ccc2c(c1)CCN2CC1CC(C)N(C)C1 |
| InChI | InChI=1S/C18H26N4.C9H10O/c1-13-7-14(11-21(13)2)12-22-6-5-16-8-15(3-4-18(16)22)17(9-19)10-20;10-8-4-7-9-5-2-1-3-6-9/h3-4,8-10,13-14,19H,5-7,11-12,20H2,1-2H3;1-3,5-6,8H,4,7H2/b17-10+,19-9+; |
| InChIKey | BTYUVZFSRADFIT-RSXNUKMNSA-N |
| XLogP | 4.16 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|