C19H24FN7 — CID 144694687
4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]-1-methylpyrazole-5-carboximidoyl]aniline (PubChem CID 144694687) has the molecular formula C19H24FN7 and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]-1-methylpyrazole-5-carboximidoyl]aniline.
| Compound Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]-1-methylpyrazole-5-carboximidoyl]aniline |
|---|---|
| PubChem CID | 144694687 |
| Molecular Formula | C19H24FN7 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-[3-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]-1-methylpyrazole-5-carboximidoyl]aniline |
| SMILES | [H]/N=C(/c1cc(C(=C/N)/C=N/[H])ccc1N)c1cc(N2CC[C@@H](CF)C2)nn1C |
| InChI | InChI=1S/C19H24FN7/c1-26-17(7-18(25-26)27-5-4-12(8-20)11-27)19(24)15-6-13(2-3-16(15)23)14(9-21)10-22/h2-3,6-7,9-10,12,21,24H,4-5,8,11,22-23H2,1H3/b14-10+,21-9+,24-19-/t12-/m0/s1 |
| InChIKey | KPBZNNVDEPRDRE-OVBHDFBMSA-N |
| XLogP | 2.16 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|