C18H19F3N4O — CID 144697617
2-[2-[(3R)-3-methylpyrrolidin-1-yl]pyridine-4-carboximidoyl]-4-(trifluoromethoxy)aniline (PubChem CID 144697617) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-[2-[(3R)-3-methylpyrrolidin-1-yl]pyridine-4-carboximidoyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 2-[2-[(3R)-3-methylpyrrolidin-1-yl]pyridine-4-carboximidoyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 144697617 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[2-[(3R)-3-methylpyrrolidin-1-yl]pyridine-4-carboximidoyl]-4-(trifluoromethoxy)aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CC[C@@H](C)C2)c1)c1cc(OC(F)(F)F)ccc1N |
| InChI | InChI=1S/C18H19F3N4O/c1-11-5-7-25(10-11)16-8-12(4-6-24-16)17(23)14-9-13(2-3-15(14)22)26-18(19,20)21/h2-4,6,8-9,11,23H,5,7,10,22H2,1H3/b23-17+/t11-/m1/s1 |
| InChIKey | ZWWKLNUBIONOTD-OFSDHFDJSA-N |
| XLogP | 3.82 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|