C19H25N5 — CID 159549771
2-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyridine-4-carboximidoyl]benzene-1,4-diamine (PubChem CID 159549771) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyridine-4-carboximidoyl]benzene-1,4-diamine.
| Compound Name | 2-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyridine-4-carboximidoyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 159549771 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyridine-4-carboximidoyl]benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1ccnc(N2C[C@H](C)C[C@H](C)C2)c1)c1cc(N)ccc1N |
| InChI | InChI=1S/C19H25N5/c1-12-7-13(2)11-24(10-12)18-8-14(5-6-23-18)19(22)16-9-15(20)3-4-17(16)21/h3-6,8-9,12-13,22H,7,10-11,20-21H2,1-2H3/b22-19+/t12-,13+ |
| InChIKey | MFFXVKRLNGSVEE-CTWFEBGRSA-N |
| XLogP | 3.14 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|