C20H25N5O2 — CID 144795347
4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine (PubChem CID 144795347) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine.
| Compound Name | 4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
|---|---|
| PubChem CID | 144795347 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-[2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyridine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
| SMILES | [H]/N=C(\c1ccnc(N2CC3CCC(C2)O3)c1)c1cc(OC(C)C)ncc1N |
| InChI | InChI=1S/C20H25N5O2/c1-12(2)26-19-8-16(17(21)9-24-19)20(22)13-5-6-23-18(7-13)25-10-14-3-4-15(11-25)27-14/h5-9,12,14-15,22H,3-4,10-11,21H2,1-2H3/b22-20+ |
| InChIKey | CDJSCKXBKNUSKE-LSDHQDQOSA-N |
| XLogP | 2.63 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|