C22H29N7O2 — CID 144697636
(NZ)-N-[1-[4-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]piperazin-1-yl]-1-iminopropan-2-ylidene]hydroxylamine (PubChem CID 144697636) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (NZ)-N-[1-[4-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]piperazin-1-yl]-1-iminopropan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[4-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]piperazin-1-yl]-1-iminopropan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 144697636 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (NZ)-N-[1-[4-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]piperazin-1-yl]-1-iminopropan-2-ylidene]hydroxylamine |
| SMILES | [H]/N=C(\c1ccnc(N2CCN(C(=N/[H])/C(C)=N\O)CC2)c1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C22H29N7O2/c1-14(2)31-17-4-5-19(23)18(13-17)21(24)16-6-7-26-20(12-16)28-8-10-29(11-9-28)22(25)15(3)27-30/h4-7,12-14,24-25,30H,8-11,23H2,1-3H3/b24-21+,25-22+,27-15- |
| InChIKey | IDSLZQVPHBRRDL-IFVXRTNISA-N |
| XLogP | 2.82 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|