C15H18N4O2 — CID 144697614
N-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]hydroxylamine (PubChem CID 144697614) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]hydroxylamine.
| Compound Name | N-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]hydroxylamine |
|---|---|
| PubChem CID | 144697614 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-[4-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)-2-pyridinyl]hydroxylamine |
| SMILES | [H]/N=C(\c1ccnc(NO)c1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C15H18N4O2/c1-9(2)21-11-3-4-13(16)12(8-11)15(17)10-5-6-18-14(7-10)19-20/h3-9,17,20H,16H2,1-2H3,(H,18,19)/b17-15+ |
| InChIKey | ANJCMSXEJDCKQL-BMRADRMJSA-N |
| XLogP | 2.67 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|