C18H22N4O2 — CID 144697647
4-ethoxy-2-[2-(3-methoxyazetidin-1-yl)pyridine-4-carboximidoyl]aniline (PubChem CID 144697647) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-ethoxy-2-[2-(3-methoxyazetidin-1-yl)pyridine-4-carboximidoyl]aniline.
| Compound Name | 4-ethoxy-2-[2-(3-methoxyazetidin-1-yl)pyridine-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 144697647 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-ethoxy-2-[2-(3-methoxyazetidin-1-yl)pyridine-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CC(OC)C2)c1)c1cc(OCC)ccc1N |
| InChI | InChI=1S/C18H22N4O2/c1-3-24-13-4-5-16(19)15(9-13)18(20)12-6-7-21-17(8-12)22-10-14(11-22)23-2/h4-9,14,20H,3,10-11,19H2,1-2H3/b20-18+ |
| InChIKey | AZQNLCLZHCVVFJ-CZIZESTLSA-N |
| XLogP | 2.31 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|