C19H24N4O3 — CID 144695104
molecular hydrogen;2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(oxetan-3-yloxy)aniline (PubChem CID 144695104) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is molecular hydrogen;2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(oxetan-3-yloxy)aniline.
| Compound Name | molecular hydrogen;2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(oxetan-3-yloxy)aniline |
|---|---|
| PubChem CID | 144695104 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | molecular hydrogen;2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(oxetan-3-yloxy)aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCOCC2)c1)c1cc(OC2COC2)ccc1N.[H][H] |
| InChI | InChI=1S/C19H22N4O3.H2/c20-17-2-1-14(26-15-11-25-12-15)10-16(17)19(21)13-3-4-22-18(9-13)23-5-7-24-8-6-23;/h1-4,9-10,15,21H,5-8,11-12,20H2;1H/b21-19+; |
| InChIKey | FZNPRQHVDALQKB-UXJRWBAGSA-N |
| XLogP | 1.94 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|