C19H19N5O2 — CID 144697869
2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(1,3-oxazol-2-yl)aniline (PubChem CID 144697869) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(1,3-oxazol-2-yl)aniline.
| Compound Name | 2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(1,3-oxazol-2-yl)aniline |
|---|---|
| PubChem CID | 144697869 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(1,3-oxazol-2-yl)aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCOCC2)c1)c1cc(-c2ncco2)ccc1N |
| InChI | InChI=1S/C19H19N5O2/c20-16-2-1-14(19-23-5-8-26-19)11-15(16)18(21)13-3-4-22-17(12-13)24-6-9-25-10-7-24/h1-5,8,11-12,21H,6-7,9-10,20H2/b21-18+ |
| InChIKey | NNZQEFCZRNVAAB-DYTRJAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|