C22H20N6O — CID 123478180
4-[4-amino-3-(6-morpholin-4-ylpyrimidine-4-carboximidoyl)phenyl]benzonitrile (PubChem CID 123478180) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[4-amino-3-(6-morpholin-4-ylpyrimidine-4-carboximidoyl)phenyl]benzonitrile.
| Compound Name | 4-[4-amino-3-(6-morpholin-4-ylpyrimidine-4-carboximidoyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 123478180 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[4-amino-3-(6-morpholin-4-ylpyrimidine-4-carboximidoyl)phenyl]benzonitrile |
| SMILES | [H]/N=C(\c1cc(N2CCOCC2)ncn1)c1cc(-c2ccc(C#N)cc2)ccc1N |
| InChI | InChI=1S/C22H20N6O/c23-13-15-1-3-16(4-2-15)17-5-6-19(24)18(11-17)22(25)20-12-21(27-14-26-20)28-7-9-29-10-8-28/h1-6,11-12,14,25H,7-10,24H2/b25-22- |
| InChIKey | HLFNMUFDAYGFIE-LVWGJNHUSA-N |
| XLogP | 2.85 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|