C19H20N8O — CID 144697097
4-[6-[2-amino-5-(1-methylpyrazol-4-yl)benzenecarboximidoyl]pyrimidin-4-yl]piperazin-2-one (PubChem CID 144697097) has the molecular formula C19H20N8O and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[6-[2-amino-5-(1-methylpyrazol-4-yl)benzenecarboximidoyl]pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 4-[6-[2-amino-5-(1-methylpyrazol-4-yl)benzenecarboximidoyl]pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 144697097 |
| Molecular Formula | C19H20N8O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-[6-[2-amino-5-(1-methylpyrazol-4-yl)benzenecarboximidoyl]pyrimidin-4-yl]piperazin-2-one |
| SMILES | [H]/N=C(\c1cc(N2CCNC(=O)C2)ncn1)c1cc(-c2cnn(C)c2)ccc1N |
| InChI | InChI=1S/C19H20N8O/c1-26-9-13(8-25-26)12-2-3-15(20)14(6-12)19(21)16-7-17(24-11-23-16)27-5-4-22-18(28)10-27/h2-3,6-9,11,21H,4-5,10,20H2,1H3,(H,22,28)/b21-19- |
| InChIKey | HWAYMVPVLCALJC-VZCXRCSSSA-N |
| XLogP | 0.81 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|