C19H21N9 — CID 130372384
2-[6-(4-pyrimidin-4-ylpiperazin-1-yl)pyrimidine-4-carboximidoyl]benzene-1,4-diamine (PubChem CID 130372384) has the molecular formula C19H21N9 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[6-(4-pyrimidin-4-ylpiperazin-1-yl)pyrimidine-4-carboximidoyl]benzene-1,4-diamine.
| Compound Name | 2-[6-(4-pyrimidin-4-ylpiperazin-1-yl)pyrimidine-4-carboximidoyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 130372384 |
| Molecular Formula | C19H21N9 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-[6-(4-pyrimidin-4-ylpiperazin-1-yl)pyrimidine-4-carboximidoyl]benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1cc(N2CCN(c3ccncn3)CC2)ncn1)c1cc(N)ccc1N |
| InChI | InChI=1S/C19H21N9/c20-13-1-2-15(21)14(9-13)19(22)16-10-18(26-12-24-16)28-7-5-27(6-8-28)17-3-4-23-11-25-17/h1-4,9-12,22H,5-8,20-21H2/b22-19- |
| InChIKey | ADXJFOZVXGXPMH-QOCHGBHMSA-N |
| XLogP | 1.17 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|