C19H26N6O — CID 144694870
2-[6-[(3S)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-methoxyaniline (PubChem CID 144694870) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-[6-[(3S)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-methoxyaniline.
| Compound Name | 2-[6-[(3S)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 144694870 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[6-[(3S)-4-ethyl-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-methoxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(CC)[C@@H](C)C2)ncn1)c1cc(OC)ccc1N |
| InChI | InChI=1S/C19H26N6O/c1-4-24-7-8-25(11-13(24)2)18-10-17(22-12-23-18)19(21)15-9-14(26-3)5-6-16(15)20/h5-6,9-10,12-13,21H,4,7-8,11,20H2,1-3H3/b21-19-/t13-/m0/s1 |
| InChIKey | PAZFIGRKZWCDON-OMEIHDDLSA-N |
| XLogP | 2.01 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|