C21H28N6O — CID 130414414
2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 130414414) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 130414414 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[6-[(3R)-3,4-dimethylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(C)[C@H](C)C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C21H28N6O/c1-14-12-27(9-8-26(14)3)19-11-18(24-13-25-19)20(23)16-10-15(4-5-17(16)22)28-21(2)6-7-21/h4-5,10-11,13-14,23H,6-9,12,22H2,1-3H3/b23-20-/t14-/m1/s1 |
| InChIKey | PBMHMVYFDBWPCR-LFAMDWDUSA-N |
| XLogP | 2.55 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|