C19H23N7O — CID 123781352
N'-[1-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]azetidin-3-yl]methanimidamide (PubChem CID 123781352) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is N'-[1-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]azetidin-3-yl]methanimidamide.
| Compound Name | N'-[1-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]azetidin-3-yl]methanimidamide |
|---|---|
| PubChem CID | 123781352 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N'-[1-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]azetidin-3-yl]methanimidamide |
| SMILES | [H]/N=C(\c1cc(N2CC(/N=C/N)C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C19H23N7O/c1-19(4-5-19)27-13-2-3-15(21)14(6-13)18(22)16-7-17(25-11-24-16)26-8-12(9-26)23-10-20/h2-3,6-7,10-12,22H,4-5,8-9,21H2,1H3,(H2,20,23)/b22-18- |
| InChIKey | YRLDDZZFBDASIN-PYCFMQQDSA-N |
| XLogP | 1.58 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|