C21H27N5O2 — CID 144694996
2-[6-[(3R)-3,5-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 144694996) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[6-[(3R)-3,5-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-[(3R)-3,5-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 144694996 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[6-[(3R)-3,5-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2C(C)COC[C@H]2C)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C21H27N5O2/c1-13-10-27-11-14(2)26(13)19-9-18(24-12-25-19)20(23)16-8-15(4-5-17(16)22)28-21(3)6-7-21/h4-5,8-9,12-14,23H,6-7,10-11,22H2,1-3H3/b23-20-/t13-,14?/m1/s1 |
| InChIKey | LQHHRHLQASYVLM-VGZPKLPJSA-N |
| XLogP | 3.02 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|