C22H28N6O — CID 123882125
2-[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 123882125) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 2-[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 123882125 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN3CCCC3C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C22H28N6O/c1-22(6-7-22)29-16-4-5-18(23)17(11-16)21(24)19-12-20(26-14-25-19)28-10-9-27-8-2-3-15(27)13-28/h4-5,11-12,14-15,24H,2-3,6-10,13,23H2,1H3/b24-21- |
| InChIKey | SWHNHWLFTWLZAF-FLFQWRMESA-N |
| XLogP | 2.69 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|