C24H30N6O3 — CID 123253872
[4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 123253872) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is [4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 123253872 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | [H]/N=C(\c1cc(N2CCN(C(=O)C3CCCO3)CC2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C24H30N6O3/c1-24(6-7-24)33-16-4-5-18(25)17(13-16)22(26)19-14-21(28-15-27-19)29-8-10-30(11-9-29)23(31)20-3-2-12-32-20/h4-5,13-15,20,26H,2-3,6-12,25H2,1H3/b26-22- |
| InChIKey | ZNHQCNPEBKPWMK-ROMGYVFFSA-N |
| XLogP | 2.23 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|