C23H28N6O3 — CID 123903473
9-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 123903473) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 9-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 123903473 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 9-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | [H]/N=C(/c1cc(N2CCC3(CC2)CNC(=O)CO3)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C23H28N6O3/c1-22(4-5-22)32-15-2-3-17(24)16(10-15)21(25)18-11-19(28-14-27-18)29-8-6-23(7-9-29)13-26-20(30)12-31-23/h2-3,10-11,14,25H,4-9,12-13,24H2,1H3,(H,26,30)/b25-21+ |
| InChIKey | RCXIBJIWSSPPDC-NJNXFGOHSA-N |
| XLogP | 1.89 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|