C22H27FN6O — CID 130414527
2-[6-[4-(2-fluoroethyl)-3-methylidenepiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 130414527) has the molecular formula C22H27FN6O and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[6-[4-(2-fluoroethyl)-3-methylidenepiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-[4-(2-fluoroethyl)-3-methylidenepiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 130414527 |
| Molecular Formula | C22H27FN6O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[6-[4-(2-fluoroethyl)-3-methylidenepiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(CCF)C(=C)C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C22H27FN6O/c1-15-13-29(10-9-28(15)8-7-23)20-12-19(26-14-27-20)21(25)17-11-16(3-4-18(17)24)30-22(2)5-6-22/h3-4,11-12,14,25H,1,5-10,13,24H2,2H3/b25-21- |
| InChIKey | LKMYJXDXDSENCV-DAFNUICNSA-N |
| XLogP | 3.01 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|