C25H34N6O3 — CID 156867036
2-[2-[(2R,6S)-4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-2,6-dimethylpiperazin-1-yl]ethoxy]acetaldehyde (PubChem CID 156867036) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[2-[(2R,6S)-4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-2,6-dimethylpiperazin-1-yl]ethoxy]acetaldehyde.
| Compound Name | 2-[2-[(2R,6S)-4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-2,6-dimethylpiperazin-1-yl]ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 156867036 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-[2-[(2R,6S)-4-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-2,6-dimethylpiperazin-1-yl]ethoxy]acetaldehyde |
| SMILES | [H]/N=C(\c1cc(N2C[C@@H](C)N(CCOCC=O)[C@@H](C)C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C25H34N6O3/c1-17-14-30(15-18(2)31(17)8-10-33-11-9-32)23-13-22(28-16-29-23)24(27)20-12-19(4-5-21(20)26)34-25(3)6-7-25/h4-5,9,12-13,16-18,27H,6-8,10-11,14-15,26H2,1-3H3/b27-24-/t17-,18+ |
| InChIKey | DAIRNXFENLYDHD-ZDIRMEFNSA-N |
| XLogP | 2.52 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|