C26H36N6O — CID 130414266
2-[6-[(3R)-4-(1-cyclopropylpropan-2-yl)-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 130414266) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is 2-[6-[(3R)-4-(1-cyclopropylpropan-2-yl)-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-[(3R)-4-(1-cyclopropylpropan-2-yl)-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 130414266 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 2-[6-[(3R)-4-(1-cyclopropylpropan-2-yl)-3-methylpiperazin-1-yl]pyrimidine-4-carboximidoyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(C(C)CC3CC3)[C@H](C)C2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C26H36N6O/c1-17(12-19-4-5-19)32-11-10-31(15-18(32)2)24-14-23(29-16-30-24)25(28)21-13-20(6-7-22(21)27)33-26(3)8-9-26/h6-7,13-14,16-19,28H,4-5,8-12,15,27H2,1-3H3/b28-25-/t17?,18-/m1/s1 |
| InChIKey | WKQMXIGPOHFVFT-LVBFCJGISA-N |
| XLogP | 4.11 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|