C18H23N5O2 — CID 144694465
(3R)-1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 144694465) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (3R)-1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 144694465 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (3R)-1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | [H]/N=C(\c1cc(N2CC[C@@H](O)C2)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C18H23N5O2/c1-11(2)25-13-3-4-15(19)14(7-13)18(20)16-8-17(22-10-21-16)23-6-5-12(24)9-23/h3-4,7-8,10-12,20,24H,5-6,9,19H2,1-2H3/b20-18-/t12-/m1/s1 |
| InChIKey | VEXVRGSQIGZIRD-LDTKGLONSA-N |
| XLogP | 1.83 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|