C19H25N5O3 — CID 130372429
[(3S)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-yl]methanol (PubChem CID 130372429) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is [(3S)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-yl]methanol.
| Compound Name | [(3S)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 130372429 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | [(3S)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-yl]methanol |
| SMILES | [H]/N=C(\c1cc(N2CC[C@H](CO)C2)ncn1)c1cc(OCCOC)ccc1N |
| InChI | InChI=1S/C19H25N5O3/c1-26-6-7-27-14-2-3-16(20)15(8-14)19(21)17-9-18(23-12-22-17)24-5-4-13(10-24)11-25/h2-3,8-9,12-13,21,25H,4-7,10-11,20H2,1H3/b21-19-/t13-/m0/s1 |
| InChIKey | ZKNSYKCBUQRHJH-OMEIHDDLSA-N |
| XLogP | 1.32 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|