C18H23N5O3S — CID 123922387
2-[6-(3-methylsulfonylazetidin-1-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline (PubChem CID 123922387) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[6-(3-methylsulfonylazetidin-1-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline.
| Compound Name | 2-[6-(3-methylsulfonylazetidin-1-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 123922387 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[6-(3-methylsulfonylazetidin-1-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CC(S(C)(=O)=O)C2)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C18H23N5O3S/c1-11(2)26-12-4-5-15(19)14(6-12)18(20)16-7-17(22-10-21-16)23-8-13(9-23)27(3,24)25/h4-7,10-11,13,20H,8-9,19H2,1-3H3/b20-18- |
| InChIKey | HDHICPFAYVWSPP-ZZEZOPTASA-N |
| XLogP | 1.50 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|