C19H25N5O2 — CID 130372406
2-[6-[(2R)-2-methylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline (PubChem CID 130372406) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[6-[(2R)-2-methylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline.
| Compound Name | 2-[6-[(2R)-2-methylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 130372406 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[6-[(2R)-2-methylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CCO[C@H](C)C2)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C19H25N5O2/c1-12(2)26-14-4-5-16(20)15(8-14)19(21)17-9-18(23-11-22-17)24-6-7-25-13(3)10-24/h4-5,8-9,11-13,21H,6-7,10,20H2,1-3H3/b21-19-/t13-/m1/s1 |
| InChIKey | FZDPCOZKEVITKV-IUXHBZJFSA-N |
| XLogP | 2.49 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|