C19H25N5O2 — CID 123896610
1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperidin-4-ol (PubChem CID 123896610) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 123896610 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperidin-4-ol |
| SMILES | [H]/N=C(\c1cc(N2CCC(O)CC2)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C19H25N5O2/c1-12(2)26-14-3-4-16(20)15(9-14)19(21)17-10-18(23-11-22-17)24-7-5-13(25)6-8-24/h3-4,9-13,21,25H,5-8,20H2,1-2H3/b21-19- |
| InChIKey | GATFZQUXDATBJC-VZCXRCSSSA-N |
| XLogP | 2.22 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|