C18H23N5O3 — CID 144697096
(3R)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 144697096) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3R)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 144697096 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (3R)-1-[6-[2-amino-5-(2-methoxyethoxy)benzenecarboximidoyl]pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | [H]/N=C(\c1cc(N2CC[C@@H](O)C2)ncn1)c1cc(OCCOC)ccc1N |
| InChI | InChI=1S/C18H23N5O3/c1-25-6-7-26-13-2-3-15(19)14(8-13)18(20)16-9-17(22-11-21-16)23-5-4-12(24)10-23/h2-3,8-9,11-12,20,24H,4-7,10,19H2,1H3/b20-18-/t12-/m1/s1 |
| InChIKey | NQTGEPGWNYKCIN-LDTKGLONSA-N |
| XLogP | 1.07 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|