C20H24FN5O2 — CID 130372423
5-fluoro-2-[6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline (PubChem CID 130372423) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 5-fluoro-2-[6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline.
| Compound Name | 5-fluoro-2-[6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 130372423 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 5-fluoro-2-[6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)pyrimidine-4-carboximidoyl]-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\c1cc(N2CC3CCC(C2)O3)ncn1)c1cc(OC(C)C)c(F)cc1N |
| InChI | InChI=1S/C20H24FN5O2/c1-11(2)27-18-5-14(16(22)6-15(18)21)20(23)17-7-19(25-10-24-17)26-8-12-3-4-13(9-26)28-12/h5-7,10-13,23H,3-4,8-9,22H2,1-2H3/b23-20- |
| InChIKey | QDZCLMWAQXMLOX-ATJXCDBQSA-N |
| XLogP | 2.77 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|