C19H21FN8O — CID 144694428
2-[6-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 144694428) has the molecular formula C19H21FN8O and a molecular weight of 396.43 g/mol. Its IUPAC name is 2-[6-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-[6-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 144694428 |
| Molecular Formula | C19H21FN8O |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[6-(6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl)pyrimidine-4-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(/c1cc(N2CCn3ncnc3C2)ncn1)c1cc(OC(C)C)c(F)cc1N |
| InChI | InChI=1S/C19H21FN8O/c1-11(2)29-16-5-12(14(21)6-13(16)20)19(22)15-7-17(24-9-23-15)27-3-4-28-18(8-27)25-10-26-28/h5-7,9-11,22H,3-4,8,21H2,1-2H3/b22-19+ |
| InChIKey | RJRRKRIIULZEKJ-ZBJSNUHESA-N |
| XLogP | 2.01 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|