C21H29FN6O2 — CID 123564339
3-[4-[6-(2-amino-4-fluoro-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperazin-1-yl]propan-1-ol (PubChem CID 123564339) has the molecular formula C21H29FN6O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-[4-[6-(2-amino-4-fluoro-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[6-(2-amino-4-fluoro-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 123564339 |
| Molecular Formula | C21H29FN6O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[4-[6-(2-amino-4-fluoro-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]piperazin-1-yl]propan-1-ol |
| SMILES | [H]/N=C(\c1cc(N2CCN(CCCO)CC2)ncn1)c1cc(OC(C)C)c(F)cc1N |
| InChI | InChI=1S/C21H29FN6O2/c1-14(2)30-19-10-15(17(23)11-16(19)22)21(24)18-12-20(26-13-25-18)28-7-5-27(6-8-28)4-3-9-29/h10-14,24,29H,3-9,23H2,1-2H3/b24-21- |
| InChIKey | ISPIBRAMUINRPG-FLFQWRMESA-N |
| XLogP | 1.91 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|