C19H27N7O2 — CID 139566251
2-[4-[6-(5-amino-2-propan-2-yloxypyridine-4-carboximidoyl)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 139566251) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[4-[6-(5-amino-2-propan-2-yloxypyridine-4-carboximidoyl)pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-(5-amino-2-propan-2-yloxypyridine-4-carboximidoyl)pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 139566251 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-[4-[6-(5-amino-2-propan-2-yloxypyridine-4-carboximidoyl)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | [H]/N=C(\c1cc(N2CCN(CCO)CC2)ncn1)c1cc(OC(C)C)ncc1N |
| InChI | InChI=1S/C19H27N7O2/c1-13(2)28-18-9-14(15(20)11-22-18)19(21)16-10-17(24-12-23-16)26-5-3-25(4-6-26)7-8-27/h9-13,21,27H,3-8,20H2,1-2H3/b21-19- |
| InChIKey | SZBUVTFEUGIZED-VZCXRCSSSA-N |
| XLogP | 0.77 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|