C18H24N6O2S — CID 144795318
4-[6-(1-oxo-1,4-thiazepan-4-yl)pyrimidine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine (PubChem CID 144795318) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 4-[6-(1-oxo-1,4-thiazepan-4-yl)pyrimidine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine.
| Compound Name | 4-[6-(1-oxo-1,4-thiazepan-4-yl)pyrimidine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
|---|---|
| PubChem CID | 144795318 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-[6-(1-oxo-1,4-thiazepan-4-yl)pyrimidine-4-carboximidoyl]-6-propan-2-yloxypyridin-3-amine |
| SMILES | [H]/N=C(/c1cc(N2CCCS(=O)CC2)ncn1)c1cc(OC(C)C)ncc1N |
| InChI | InChI=1S/C18H24N6O2S/c1-12(2)26-17-8-13(14(19)10-21-17)18(20)15-9-16(23-11-22-15)24-4-3-6-27(25)7-5-24/h8-12,20H,3-7,19H2,1-2H3/b20-18+ |
| InChIKey | CQZAWYMNCPGTJO-CZIZESTLSA-N |
| XLogP | 1.62 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|