C16H20N6O — CID 137229950
4-amino-3-[6-(4-methylpiperazin-1-yl)pyrimidine-4-carboximidoyl]phenol (PubChem CID 137229950) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-amino-3-[6-(4-methylpiperazin-1-yl)pyrimidine-4-carboximidoyl]phenol.
| Compound Name | 4-amino-3-[6-(4-methylpiperazin-1-yl)pyrimidine-4-carboximidoyl]phenol |
|---|---|
| PubChem CID | 137229950 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-amino-3-[6-(4-methylpiperazin-1-yl)pyrimidine-4-carboximidoyl]phenol |
| SMILES | [H]/N=C(\c1cc(N2CCN(C)CC2)ncn1)c1cc(O)ccc1N |
| InChI | InChI=1S/C16H20N6O/c1-21-4-6-22(7-5-21)15-9-14(19-10-20-15)16(18)12-8-11(23)2-3-13(12)17/h2-3,8-10,18,23H,4-7,17H2,1H3/b18-16- |
| InChIKey | MDQWFDSFDIGIDL-VLGSPTGOSA-N |
| XLogP | 0.93 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|