C22H27N7OS — CID 144697138
methanol;2-[6-(4-methylsulfanylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-4-pyridin-3-ylaniline (PubChem CID 144697138) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is methanol;2-[6-(4-methylsulfanylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-4-pyridin-3-ylaniline.
| Compound Name | methanol;2-[6-(4-methylsulfanylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-4-pyridin-3-ylaniline |
|---|---|
| PubChem CID | 144697138 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | methanol;2-[6-(4-methylsulfanylpiperazin-1-yl)pyrimidine-4-carboximidoyl]-4-pyridin-3-ylaniline |
| SMILES | CO.[H]/N=C(\c1cc(N2CCN(SC)CC2)ncn1)c1cc(-c2cccnc2)ccc1N |
| InChI | InChI=1S/C21H23N7S.CH4O/c1-29-28-9-7-27(8-10-28)20-12-19(25-14-26-20)21(23)17-11-15(4-5-18(17)22)16-3-2-6-24-13-16;1-2/h2-6,11-14,23H,7-10,22H2,1H3;2H,1H3/b23-21-; |
| InChIKey | YGRIGPBTNWSTRN-VZXGSGAOSA-N |
| XLogP | 2.55 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|