C22H25N7O2 — CID 144694480
2-[6-[(2R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(5-methoxypyrazin-2-yl)aniline (PubChem CID 144694480) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-[6-[(2R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(5-methoxypyrazin-2-yl)aniline.
| Compound Name | 2-[6-[(2R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(5-methoxypyrazin-2-yl)aniline |
|---|---|
| PubChem CID | 144694480 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[6-[(2R)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(5-methoxypyrazin-2-yl)aniline |
| SMILES | [H]/N=C(\c1cc(N2CC(C)O[C@H](C)C2)ncn1)c1cc(-c2cnc(OC)cn2)ccc1N |
| InChI | InChI=1S/C22H25N7O2/c1-13-10-29(11-14(2)31-13)20-7-18(27-12-28-20)22(24)16-6-15(4-5-17(16)23)19-8-26-21(30-3)9-25-19/h4-9,12-14,24H,10-11,23H2,1-3H3/b24-22-/t13-,14?/m1/s1 |
| InChIKey | NDGGTBSAUCUJGK-LCGPJNHBSA-N |
| XLogP | 2.55 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|