C16H18N4O — CID 165137446
4-(1-methylcyclopropyl)oxy-2-(6-methylpyrimidine-4-carboximidoyl)aniline (PubChem CID 165137446) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-(1-methylcyclopropyl)oxy-2-(6-methylpyrimidine-4-carboximidoyl)aniline.
| Compound Name | 4-(1-methylcyclopropyl)oxy-2-(6-methylpyrimidine-4-carboximidoyl)aniline |
|---|---|
| PubChem CID | 165137446 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-(1-methylcyclopropyl)oxy-2-(6-methylpyrimidine-4-carboximidoyl)aniline |
| SMILES | [H]/N=C(\c1cc(C)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C16H18N4O/c1-10-7-14(20-9-19-10)15(18)12-8-11(3-4-13(12)17)21-16(2)5-6-16/h3-4,7-9,18H,5-6,17H2,1-2H3/b18-15- |
| InChIKey | PXCPHNRMIDWIMK-SDXDJHTJSA-N |
| XLogP | 2.71 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|