C23H28N6O2 — CID 123391746
8-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 123391746) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 8-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 123391746 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 8-[6-[2-amino-5-(1-methylcyclopropyl)oxybenzenecarboximidoyl]pyrimidin-4-yl]-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C(/c1cc(N2CCC3(CCC(=O)N3)CC2)ncn1)c1cc(OC2(C)CC2)ccc1N |
| InChI | InChI=1S/C23H28N6O2/c1-22(6-7-22)31-15-2-3-17(24)16(12-15)21(25)18-13-19(27-14-26-18)29-10-8-23(9-11-29)5-4-20(30)28-23/h2-3,12-14,25H,4-11,24H2,1H3,(H,28,30)/b25-21+ |
| InChIKey | VNNBUBAAULPPOH-NJNXFGOHSA-N |
| XLogP | 2.66 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|